3-Methoxy-2-nitrobenzamide structure
|
Common Name | 3-Methoxy-2-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 99595-85-4 | Molecular Weight | 196.16000 | |
| Density | 1.362g/cm3 | Boiling Point | 321.5ºC at 760 mmHg | |
| Molecular Formula | C8H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.2ºC | |
| Name | 3-methoxy-2-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.362g/cm3 |
|---|---|
| Boiling Point | 321.5ºC at 760 mmHg |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16000 |
| Flash Point | 148.2ºC |
| Exact Mass | 196.04800 |
| PSA | 98.14000 |
| LogP | 1.92580 |
| Index of Refraction | 1.587 |
| InChIKey | MZGJDLQJIXSZRB-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(N)=O)c1[N+](=O)[O-] |
| Storage condition | 2-8℃ |
|
~94%
3-Methoxy-2-nit... CAS#:99595-85-4 |
| Literature: Pfizer Inc. Patent: US5482941 A1, 1996 ; US 5482941 A |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Antibacterial activity against Bacillus subtilis 168
Source: ChEMBL
Target: Bacillus subtilis
External Id: CHEMBL1032392
|
|
Name: Inhibition of FtsZ-mediated cell division in Bacillus subtilis 168 assessed as effect...
Source: ChEMBL
Target: Cell division protein FtsZ
External Id: CHEMBL1032394
|
| 3-Methoxy-2-nitro-benzamide |
| BEN061 |
| 3-Methoxy-2-nitro-benzoesaeure-amid |
| 3-methoxy-2-nitro-benzoic acid amide |
| 2-Nitro-3-methoxy-benzamid |
| 2-Nitro-m-anisamide |