Kazinol A structure
|
Common Name | Kazinol A | ||
|---|---|---|---|---|
| CAS Number | 99624-28-9 | Molecular Weight | 394.50 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H30O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Kazinol AKazinol A induces cytotoxic effects in human bladder cancer cells, including the cisplatin-resistant T24R2[1]. |
| Name | 4-[(2S)-7-hydroxy-3,4-dihydro-2H-chromen-2-yl]-3,6-bis(3-methylbut-2-enyl)benzene-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Description | Kazinol A induces cytotoxic effects in human bladder cancer cells, including the cisplatin-resistant T24R2[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C25H30O4 |
|---|---|
| Molecular Weight | 394.50 |
| Exact Mass | 394.21400 |
| PSA | 69.92000 |
| LogP | 5.88710 |
| InChIKey | QXHVECWDOBLWPW-QFIPXVFZSA-N |
| SMILES | CC(C)=CCc1cc(C2CCc3ccc(O)cc3O2)c(CC=C(C)C)c(O)c1O |
| Hazard Codes | Xi |
|---|
| Kazinol A |