2-(tert-Butyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane structure
|
Common Name | 2-(tert-Butyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | ||
|---|---|---|---|---|
| CAS Number | 99810-76-1 | Molecular Weight | 184.083 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 186.5±9.0 °C at 760 mmHg | |
| Molecular Formula | C10H21BO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 66.6±18.7 °C | |
| Name | 2-(tert-Butyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 186.5±9.0 °C at 760 mmHg |
| Molecular Formula | C10H21BO2 |
| Molecular Weight | 184.083 |
| Flash Point | 66.6±18.7 °C |
| Exact Mass | 184.163467 |
| PSA | 18.46000 |
| LogP | 2.87870 |
| Vapour Pressure | 0.9±0.3 mmHg at 25°C |
| Index of Refraction | 1.419 |
| InChIKey | ZQEPUUOQJIWIFJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)B1OC(C)(C)C(C)(C)O1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934999090 |
|
~%
2-(tert-Butyl)-... CAS#:99810-76-1 |
| Literature: Journal of Organic Chemistry, , vol. 76, # 23 p. 9602 - 9610 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,4,5,5-Tetramethyl-2-(2-methyl-2-propanyl)-1,3,2-dioxaborolane |
| 1,3,2-Dioxaborolane, 2-(1,1-dimethylethyl)-4,4,5,5-tetramethyl- |
| 2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |