3-(4-hydroxy-3-methoxyphenyl)-2-methylprop-2-enoic acid structure
|
Common Name | 3-(4-hydroxy-3-methoxyphenyl)-2-methylprop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 99865-71-1 | Molecular Weight | 208.21100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-hydroxy-3-methoxyphenyl)-2-methylprop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12O4 |
|---|---|
| Molecular Weight | 208.21100 |
| Exact Mass | 208.07400 |
| PSA | 66.76000 |
| LogP | 1.88870 |
| InChIKey | YHOAZFMXZXWRHC-UHFFFAOYSA-N |
| SMILES | COc1cc(C=C(C)C(=O)O)ccc1O |
| HS Code | 2918990090 |
|---|
|
~%
3-(4-hydroxy-3-... CAS#:99865-71-1 |
| Literature: Mann; Woolf Journal of the American Chemical Society, 1957 , vol. 79, p. 120,125 |
|
~%
3-(4-hydroxy-3-... CAS#:99865-71-1 |
| Literature: Gensler; Berman Journal of the American Chemical Society, 1958 , vol. 80, p. 4949,4952 |
|
~%
3-(4-hydroxy-3-... CAS#:99865-71-1 |
| Literature: Tiemann; Kraaz Chemische Berichte, 1882 , vol. 15, p. 2063 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Methylaether-homokaffeesaeure |
| 3-(4-Hydroxy-3-methoxy-phenyl)-2-methyl-acrylsaeure |
| 3-(4-hydroxy-3-methoxy-phenyl)-2-methyl-acrylic acid |
| Homoferulasaeure |