2-(2-bromophenoxy)-5-nitrobenzonitrile structure
|
Common Name | 2-(2-bromophenoxy)-5-nitrobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 99902-78-0 | Molecular Weight | 319.11000 | |
| Density | 1.67g/cm3 | Boiling Point | 385.9ºC at 760mmHg | |
| Molecular Formula | C13H7BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.2ºC | |
| Name | 2-(2-bromophenoxy)-5-nitrobenzonitrile |
|---|
| Density | 1.67g/cm3 |
|---|---|
| Boiling Point | 385.9ºC at 760mmHg |
| Molecular Formula | C13H7BrN2O3 |
| Molecular Weight | 319.11000 |
| Flash Point | 187.2ºC |
| Exact Mass | 317.96400 |
| PSA | 78.84000 |
| LogP | 4.54448 |
| Index of Refraction | 1.672 |
| InChIKey | CZDHZBVMEVXJAT-UHFFFAOYSA-N |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1Oc1ccccc1Br |
|
~%
2-(2-bromopheno... CAS#:99902-78-0 |
| Literature: Markley; Tong; Dulworth; Steward; Goralski; Johnston; Wood; Vinogradoff; Bargar Journal of Medicinal Chemistry, 1986 , vol. 29, # 3 p. 427 - 433 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |