2-Chloro-5-nitrobenzonitrile structure
|
Common Name | 2-Chloro-5-nitrobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 16588-02-6 | Molecular Weight | 182.564 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 300.3±27.0 °C at 760 mmHg | |
| Molecular Formula | C7H3ClN2O2 | Melting Point | 105-108ºC | |
| MSDS | Chinese USA | Flash Point | 135.4±23.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Chloro-5-nitrobenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 300.3±27.0 °C at 760 mmHg |
| Melting Point | 105-108ºC |
| Molecular Formula | C7H3ClN2O2 |
| Molecular Weight | 182.564 |
| Flash Point | 135.4±23.7 °C |
| Exact Mass | 181.988312 |
| PSA | 69.61000 |
| LogP | 1.79 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | ZGILLTVEEBNDOB-UHFFFAOYSA-N |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1Cl |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H312 + H332-H315-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | UN 3276 |
| WGK Germany | 3 |
| RTECS | DI3040000 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
|
Enzyme kinetics and substrate selectivities of rat glutathione S-transferase isoenzymes towards a series of new 2-substituted 1-chloro-4-nitrobenzenes.
Xenobiotica 26(2) , 143-55, (1996) 1. Four different rat glutathione S-transferase (GST) isoenzymes, belonging to three different classes, were examined for their GSH conjugating capacity towards 11 2-substituted 1-chloro-4-nitrobenzen... |
|
|
Online biochemical detection of glutathione-S-transferase P1-specific inhibitors in complex mixtures.
J. Biomol. Screen. 12(3) , 396-405, (2007) A high-resolution screening (HRS) technology is described, which couples 2 parallel enzyme affinity detection (EAD) systems for substrates and inhibitors of rat cytosolic glutathione-S-transferases (c... |
| 2-Chlor-5-nitrobenzolcarbonitril |
| 2-chlor-5-nitrobenzonitrile |
| 2-Chloro-5-nitrobenzenenitrile |
| 3-cyano-4-chloronitrobenzene |
| MFCD00007292 |
| 4-chloro-3-cyanonitrobenzene |
| 1-CHLORO-2-CYANO-4-NITROBENZENE |
| 2-chlor-5-nitrobenzonitril |
| 2-chloro-5-nitro-benzonitrile |
| 2-cyano-4-nitrochlorobenzene |
| EINECS 240-643-6 |
| 2-chloro-5-nitro-benzonitril |
| Benzonitrile, 2-chloro-5-nitro- |
| 4-Chloro-3-cyano-1-nitrobenzene |
| 5-Nitro-2-chlorobenzonitrile |
| 2-chloro-3-cyano-5-nitrobenzene |
| BENZONITRILE,2-CHLORO-5-NITRO |
| 2-Chloro-5-nitrobenzonitrile |
| 2-Chloro-1-cyano-5-nitrobenzene |