2-(3,4-dichlorophenoxy)pyridine-3-carbonitrile structure
|
Common Name | 2-(3,4-dichlorophenoxy)pyridine-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 99902-93-9 | Molecular Weight | 265.09500 | |
| Density | 1.46g/cm3 | Boiling Point | 388.7ºC at 760 mmHg | |
| Molecular Formula | C12H6Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.9ºC | |
| Name | 2-(3,4-dichlorophenoxy)pyridine-3-carbonitrile |
|---|
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 388.7ºC at 760 mmHg |
| Molecular Formula | C12H6Cl2N2O |
| Molecular Weight | 265.09500 |
| Flash Point | 188.9ºC |
| Exact Mass | 263.98600 |
| PSA | 45.91000 |
| LogP | 4.05238 |
| Index of Refraction | 1.637 |
| InChIKey | XYVUJRFTULRGGP-UHFFFAOYSA-N |
| SMILES | N#Cc1cccnc1Oc1ccc(Cl)c(Cl)c1 |
|
~%
2-(3,4-dichloro... CAS#:99902-93-9 |
| Literature: Markley; Tong; Dulworth; Steward; Goralski; Johnston; Wood; Vinogradoff; Bargar Journal of Medicinal Chemistry, 1986 , vol. 29, # 3 p. 427 - 433 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |