4-(2-bromophenyl)piperidine-2,6-dione structure
|
Common Name | 4-(2-bromophenyl)piperidine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 99983-26-3 | Molecular Weight | 268.10700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2-bromophenyl)piperidine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10BrNO2 |
|---|---|
| Molecular Weight | 268.10700 |
| Exact Mass | 266.98900 |
| PSA | 49.66000 |
| LogP | 2.24520 |
| InChIKey | JELSMZSISXNIMR-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2ccccc2Br)CC(=O)N1 |
| Storage condition | 2-8°C |
| HS Code | 2925190090 |
|---|
|
~%
4-(2-bromopheny... CAS#:99983-26-3 |
| Literature: Kozaka, Takashi; Uno, Izumi; Kitamura, Yoji; Miwa, Daisuke; Ogawa, Kazuma; Shiba, Kazuhiro Bioorganic and Medicinal Chemistry, 2012 , vol. 20, # 16 p. 4936 - 4941 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-(2-Bromphenyl)-glutarsaeureimid |