Abscisic acid structure
|
Common Name | Abscisic acid | ||
|---|---|---|---|---|
| CAS Number | 21293-29-8 | Molecular Weight | 264.317 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 458.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H20O4 | Melting Point | 188ºC | |
| MSDS | Chinese USA | Flash Point | 245.4±25.2 °C | |
Use of Abscisic acidAbscisic acid ((S)-(+)-Abscisic acid) is a plant hormone which is as a growth inhibitor. Abscisic acid has been shown to regulate many aspects of plant growth and development including embryo maturation, seed dormancy, germination, cell division and elongation, floral induction, and responses to environmental stresses such as drought, salinity, cold, pathogen attack and UV radiation[1]. |
| Name | (+)-abscisic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Abscisic acid ((S)-(+)-Abscisic acid) is a plant hormone which is as a growth inhibitor. Abscisic acid has been shown to regulate many aspects of plant growth and development including embryo maturation, seed dormancy, germination, cell division and elongation, floral induction, and responses to environmental stresses such as drought, salinity, cold, pathogen attack and UV radiation[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Ruth Finkelstein,et al. Abscisic Acid Synthesis and Response. Arabidopsis Book. 2013; 11. |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 458.7±45.0 °C at 760 mmHg |
| Melting Point | 188ºC |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.317 |
| Flash Point | 245.4±25.2 °C |
| Exact Mass | 264.136169 |
| PSA | 74.60000 |
| LogP | 1.70 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | JLIDBLDQVAYHNE-IBPUIESWSA-N |
| SMILES | CC(C=CC1(O)C(C)=CC(=O)CC1(C)C)=CC(=O)O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
|
Degradation of the ABA co-receptor ABI1 by PUB12/13 U-box E3 ligases.
Nat. Commun. 6 , 8630, (2015) Clade A protein phosphatase 2Cs (PP2Cs) are abscisic acid (ABA) co-receptors that block ABA signalling by inhibiting the downstream protein kinases. ABA signalling is activated after PP2Cs are inhibit... |
|
|
The RING E3 Ligase KEEP ON GOING Modulates JASMONATE ZIM-DOMAIN12 Stability.
Plant Physiol. 169 , 1405-17, (2015) Jasmonate (JA) signaling in plants is mediated by the JASMONATE ZIM-DOMAIN (JAZ) proteins that repress the activity of several transcription factors regulating JA-inducible gene expression. The hormon... |
|
|
Casein Kinase 2 Negatively Regulates Abscisic Acid-Activated SnRK2s in the Core Abscisic Acid-Signaling Module.
Mol. Plant 8 , 709-21, (2015) SnRK2 kinases, PP2C phosphatases and the PYR/PYL/RCAR receptors constitute the core abscisic acid (ABA) signaling module that is thought to contain all of the intrinsic properties to self-regulate the... |
| ABA |
| cis-trans-(+)-Abscissic acid |
| (+)-(S)-ABA |
| (S)-5-(1-Hydroxy-2,6,6-trimethyl-4-oxo-2-cyclohexen-1-yl)-3-methyl-(2Z,4E)-pentadienoic acid |
| (2Z,4E)-5-[(1S)-1-Hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
| (S)-(+)-Abscisic Acid |
| (+)-(S)-Abscisic Acid |
| (2Z,4E)-5-[(1S)-Hydroxy-2,6,6-trimethyl-4-oxo-2-cyclohexen-1-yl]-3-methyl-2,4-pentadienoic Acid |
| (2Z,4E)-5-[(1S)-1-Hydroxy-2,6,6-trimethyl-4-oxo-2-cyclohexen-1-yl]-3-methyl-2,4-pentadienoic acid |
| Abscisic acid |
| S-(+)-Abscisic acid |
| (2Z,4E)-5-((S)-1-Hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid |
| (S-(Z,E))-5-(1-Hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid |
| (2Z,4E)-5-(1-Hydroxy-2,6,6-trimethyl-4-oxo-2-cyclohexen-1-yl)-3-methyl-2,4-pentadienoic acid |
| DORMIN |
| UNII:3B18Y5RNGK |
| (±)-cis,trans-abscisic acid |
| (+)-Cis,Trans-AbsCisic Acid |
| (rac)-Abscisic acid |
| (7E,9Z)-(6S)-6-hydroxy-3-oxo-11-apo-ε-caroten-11-oic acid |
| EINECS 244-319-5 |
| (+)-(cis,trans)-Abscisic Acid |
| (7E,9Z)-(6S)-6-Hydroxy-3-oxo-11-apo-e-caroten-11-oic Acid |
| (+)-Abscisic acid |
| (2Z,4E)-5-(1-Hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid |
| MFCD00066545 |