1-Boc-4-Cyanopiperidine structure
|
Common Name | 1-Boc-4-Cyanopiperidine | ||
|---|---|---|---|---|
| CAS Number | 91419-52-2 | Molecular Weight | 210.273 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 325.3±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H18N2O2 | Melting Point | 60-62°C | |
| MSDS | Chinese USA | Flash Point | 150.5±25.9 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | 1-Boc-4-cyanopiperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 325.3±35.0 °C at 760 mmHg |
| Melting Point | 60-62°C |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.273 |
| Flash Point | 150.5±25.9 °C |
| Exact Mass | 210.136826 |
| PSA | 53.33000 |
| LogP | 0.88 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.488 |
| InChIKey | UQADQTBQNVARAP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C#N)CC1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319-H400 |
| Precautionary Statements | P273-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn;N |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S36-S36/37/39 |
| RIDADR | 3439 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2933399090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 4-cyanopiperidine-1-carboxylate |
| 2-Methyl-2-propanyl 4-cyano-1-piperidinecarboxylate |
| MFCD01861223 |
| 1-N-Boc-4-cyanopiperidine |
| N-Boc-4-Cyanopiperidine |