2-chloro-5-nitropyrimidin-4-amine structure
|
Common Name | 2-chloro-5-nitropyrimidin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 1920-66-7 | Molecular Weight | 174.545 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 446.0±25.0 °C at 760 mmHg | |
| Molecular Formula | C4H3ClN4O2 | Melting Point | 221-226ºC | |
| MSDS | Chinese USA | Flash Point | 223.5±23.2 °C | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
| Name | 2-chloro-5-nitropyrimidin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 446.0±25.0 °C at 760 mmHg |
| Melting Point | 221-226ºC |
| Molecular Formula | C4H3ClN4O2 |
| Molecular Weight | 174.545 |
| Flash Point | 223.5±23.2 °C |
| Exact Mass | 173.994446 |
| PSA | 97.62000 |
| LogP | 1.94 |
| Appearance of Characters | Solid |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.671 |
| InChIKey | RZGOEIWDMVQJBQ-UHFFFAOYSA-N |
| SMILES | Nc1nc(Cl)ncc1[N+](=O)[O-] |
| Water Solubility | Slightly soluble in water. |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H319-H334-H335 |
| Precautionary Statements | P261-P305 + P351 + P338-P342 + P311 |
| Hazard Codes | Xn |
| Risk Phrases | 22-36/37/38-43 |
| Safety Phrases | 26-36/37-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933599090 |
|
~90%
2-chloro-5-nitr... CAS#:1920-66-7 |
| Literature: Yang, Jiao; Wang, Li-Jiao; Liu, Jing-Jing; Zhong, Lei; Zheng, Ren-Lin; Xu, Yong; Ji, Pan; Zhang, Chun-Hui; Wang, Wen-Jing; Lin, Xing-Dong; Li, Lin-Li; Wei, Yu-Quan; Yang, Sheng-Yong Journal of Medicinal Chemistry, 2012 , vol. 55, # 23 p. 10685 - 10699 |
|
~%
2-chloro-5-nitr... CAS#:1920-66-7 |
| Literature: Chemische Berichte, , vol. 39, p. 252 |
| Precursor 2 | |
|---|---|
| DownStream 7 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Amino-2-chloro-5-nitropyrimidine |
| 2-chloro-4-amino-5-nitro-pyrimidine |
| 4-Pyrimidinamine,2-chloro-5-nitro |
| 2-Chloro-5-nitropyrimidin-4-amine |
| 2-Chlor-5-nitro-pyrimidin-4-ylamin |
| 2-Chloro-5-nitro-pyrimidin-4-ylamine |
| EINECS 217-648-7 |
| 4-amino-5-nitro-2-chloropyrimidine |
| MFCD00127771 |
| 2-Chloro-5-Nitro-4-Pyrimidinamine |
| F1930-0037 |