2,3-Dichloro-5,6-dicyano-1,4-benzoquinone structure
|
Common Name | 2,3-Dichloro-5,6-dicyano-1,4-benzoquinone | ||
|---|---|---|---|---|
| CAS Number | 84-58-2 | Molecular Weight | 227.004 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 301.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C8Cl2N2O2 | Melting Point | 210-215 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 136.3±27.9 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 2,3-Dichloro-5,6-dicyano-1,4-benzoquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 301.8±42.0 °C at 760 mmHg |
| Melting Point | 210-215 °C (dec.)(lit.) |
| Molecular Formula | C8Cl2N2O2 |
| Molecular Weight | 227.004 |
| Flash Point | 136.3±27.9 °C |
| Exact Mass | 225.933685 |
| PSA | 81.72000 |
| LogP | -0.54 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | HZNVUJQVZSTENZ-UHFFFAOYSA-N |
| SMILES | N#CC1=C(C#N)C(=O)C(Cl)=C(Cl)C1=O |
| Water Solubility | reacts |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 |
| Supplemental HS | Contact with water liberates toxic gas. |
| Precautionary Statements | P301 + P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T:Toxic |
| Risk Phrases | R20/21;R25;R37/38;R41 |
| Safety Phrases | S22-S24/25-S37-S45-S36/37-S26 |
| RIDADR | UN 3439 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | GU4825000 |
| Packaging Group | II |
| Hazard Class | 6.1 |
| HS Code | 2926909090 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Amino Acid-Porphyrin Conjugates: Synthesis and Study of their Photophysical and Metal Ion Recognition Properties.
Photochem. Photobiol. 91 , 1348-55, (2015) Synthesis, photophysical and metal ion recognition properties of a series of amino acid-linked free-base and Zn-porphyrin derivatives (5-9) are reported. These porphyrin derivatives showed favorable p... |
|
|
A BODIPY-luminol chemiluminescent resonance energy-transfer (CRET) cassette for imaging of cellular superoxide.
Org. Biomol. Chem. 13(6) , 1763-7, (2015) Spectroscopic and in cellulo studies are here reported on the very first BODIPY-luminol chemiluminescent resonance energy-transfer (CRET) cassette where the luminol CL agent is covalently linked to th... |
|
|
Charge-transfer complexes of 2,3-dichloro-5,6-dicyano-1,4-benzoquinone with amino molecules in polar solvents.
Spectrochim. Acta. A. Mol. Biomol. Spectrosc. 149 , 75-82, (2015) The charge-transfer complexes have scientific relevance because this type of molecular interaction is at the basis of the activity of pharmacological compounds and because the absorption bands of the ... |
| DDQ |
| 2,3-dichloro-5,6-dicyanobenzoquinone |
| 4,5-Dichloro-3,6-dioxo-1,4-cyclohexadiene-1,2-dicarbonitrile |
| EINECS 201-542-2 |
| 2,3-Dichloro-5,6-dicyano-p-benzoquinone |
| 4,5-Dichlor-3,6-dioxocyclohexa-1,4-dien-1,2-dicarbonitril |
| 2,3-Dichloro-5,6-dicyano-1,4-benzoquinone |
| dichlorodicyanobenzoquinone |
| 4,5-Dichloro-3,6-dioxocyclohexa-1,4-diene-1,2-dicarbonitrile |
| MFCD00001593 |
| dichlorodicyanoquinone |
| 1,4-Cyclohexadiene-1,2-dicarbonitrile, 4,5-dichloro-3,6-dioxo- |