2-Methyl-4-nitrobenzoic acid structure
|
Common Name | 2-Methyl-4-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1975-51-5 | Molecular Weight | 181.145 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 369.3±30.0 °C at 760 mmHg | |
| Molecular Formula | C8H7NO4 | Melting Point | 150-154ºC | |
| MSDS | Chinese USA | Flash Point | 167.6±13.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Methyl-4-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 369.3±30.0 °C at 760 mmHg |
| Melting Point | 150-154ºC |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.145 |
| Flash Point | 167.6±13.0 °C |
| Exact Mass | 181.037506 |
| PSA | 83.12000 |
| LogP | 2.35 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | XXXOBNJIIZQSPT-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])ccc1C(=O)O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H317 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22;R43 |
| Safety Phrases | S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2916399090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 217-828-5 |
| MFCD00210697 |
| 2-methyl-4-nitrobenzic acid |
| 2-Methyl-4-nitro-benzoesaeure |
| 2-Methyl-4-nitrobenzoic acid |
| 4-Nitro-o-toluylsaeure |
| 2-METHYL-4-NITROBENZOIC ACID 97 |
| 2-Methyl-4-nitrobenzoicacid |
| 4-Nitro-o-toluic acid |
| 4-Nitro-2-methylbenzoic acid |
| WNR C1 DVQ |