1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethanone structure
|
Common Name | 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 119851-28-4 | Molecular Weight | 281.134 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 369.2±37.0 °C at 760 mmHg | |
| Molecular Formula | C14H10Cl2O2 | Melting Point | 54-56°C | |
| MSDS | N/A | Flash Point | 146.5±25.5 °C | |
| Name | 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 369.2±37.0 °C at 760 mmHg |
| Melting Point | 54-56°C |
| Molecular Formula | C14H10Cl2O2 |
| Molecular Weight | 281.134 |
| Flash Point | 146.5±25.5 °C |
| Exact Mass | 280.005798 |
| PSA | 26.30000 |
| LogP | 5.05 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | BDTJIVUVQRVLLJ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(Oc2ccc(Cl)cc2)cc1Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Safety Phrases | S24/25 |
| HS Code | 2914700090 |
|
~91%
1-[2-Chloro-4-(... CAS#:119851-28-4 |
| Literature: BASF SE; ULMSCHNEIDER, Sarah; DIETZ, Jochen; RENNER, Jens; GROTE, Thomas; GRAMMENOS, Wassilios; MUeLLER, Bernd; LOHMANN, Jan Klaas; VRETTOU-SCHULTES, Marianna; RIGGS, Richard Patent: WO2010/146114 A1, 2010 ; Location in patent: Page/Page column 188 ; |
|
~%
1-[2-Chloro-4-(... CAS#:119851-28-4 |
| Literature: WO2013/10862 A1, ; Page/Page column 4 ; |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2'-Chloro-4'-(4-chlorophenoxy)acetophenone |
| MFCD00140226 |
| 4-Acetyl-3,4'-dichlorodiphenyl Ether |
| 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethanone |
| 1-[2-Chloro-4-(4-Chlorophenoxy)Phenyl]Ethan-1-One |
| GR DOR CG DV1 |