Andarine structure
|
Common Name | Andarine | ||
|---|---|---|---|---|
| CAS Number | 401900-40-1 | Molecular Weight | 441.358 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 698.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C19H18F3N3O6 | Melting Point | 70-74ºC | |
| MSDS | Chinese USA | Flash Point | 376.4±31.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of AndarineAndarine (S-4) is an investigational selective androgen receptor modulator (SARM) and an active partial agonist. |
| Name | (2S)-3-(4-acetamidophenoxy)-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| Synonym | More Synonyms |
| Description | Andarine (S-4) is an investigational selective androgen receptor modulator (SARM) and an active partial agonist. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 698.7±55.0 °C at 760 mmHg |
| Melting Point | 70-74ºC |
| Molecular Formula | C19H18F3N3O6 |
| Molecular Weight | 441.358 |
| Flash Point | 376.4±31.5 °C |
| Exact Mass | 441.114777 |
| PSA | 133.48000 |
| LogP | 4.01 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | YVXVTLGIDOACBJ-SFHVURJKSA-N |
| SMILES | CC(=O)Nc1ccc(OCC(C)(O)C(=O)Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)cc1 |
| Storage condition | Refrigerator |
| (S)-3-(4-Acetylaminophenoxy)-2-hydroxy-2-methyl-N-(4-nitro-3-trifluoromethylphenyl)propionamide |
| S-3-(4-Acetylamino-phenoxy)-2-hydroxy-2-methyl-n-(4-nitro-3-trifluoromethyl-phenyl)-propionamide |
| (2S)-3-[4-(acetylamino)phenoxy]-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
| (2S)-3-(4-Acetamidophenoxy)-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
| Andarine |
| (S-3-(4-acetylamino-phenoxy)-2-hydroxy-2-methyl-N-(4-nitro-3-trifluoromethyl-phenyl)-propionamide) |
| UNII-7UT2HAH49H |
| Ostarine |
| S4 |
| GTX007 |
| S1140_Selleck |
| MK-2866 |