7-Epitaxol
Modify Date: 2025-08-20 10:05:45
7-Epitaxol structure
|
Common Name | 7-Epitaxol | ||
|---|---|---|---|---|
| CAS Number | 105454-04-4 | Molecular Weight | 853.906 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 957.1±65.0 °C at 760 mmHg | |
| Molecular Formula | C47H51NO14 | Melting Point | 168-170?C | |
| MSDS | N/A | Flash Point | 532.6±34.3 °C | |
Use of 7-Epitaxol7-epi-Taxol is an active metabolite of taxol, with activity comparable to that of taxol against cell replication, promoting microtubule bundle formation and against microtubule depolymerization. |
| Name | 7-Epitaxol |
|---|---|
| Synonym | More Synonyms |
| Description | 7-epi-Taxol is an active metabolite of taxol, with activity comparable to that of taxol against cell replication, promoting microtubule bundle formation and against microtubule depolymerization. |
|---|---|
| Related Catalog | |
| Target |
Microtubule/Tubulin[2] |
| In Vitro | 7-epi-Taxol (7-Epitaxol) is a metabolite of taxol[1]. 7-epi-Taxol has activity comparable to that of taxol on cell replication, microtubule bundle formation and in vitro microtubule polymerization[2]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 957.1±65.0 °C at 760 mmHg |
| Melting Point | 168-170?C |
| Molecular Formula | C47H51NO14 |
| Molecular Weight | 853.906 |
| Flash Point | 532.6±34.3 °C |
| Exact Mass | 853.330933 |
| PSA | 221.29000 |
| LogP | 7.38 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | RCINICONZNJXQF-LYTKHFMESA-N |
| SMILES | CC(=O)OC1C(=O)C2(C)C(O)CC3OCC3(OC(C)=O)C2C(OC(=O)c2ccccc2)C2(O)CC(OC(=O)C(O)C(NC(=O)c3ccccc3)c3ccccc3)C(C)=C1C2(C)C |
| Storage condition | -20°C Freezer, Under Inert Atmosphere |
| HS Code | 2932999026 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:32981-85-4
CAS#:71629-92-0| HS Code | 2932999026 |
|---|
| BMS 181339-01 |
| Plaxicel |
| (2α,5β,7α,10β,13α)-4,10-Diacetoxy-13-{[(2R,3S)-3-(benzoylamino)-2-hydroxy-3-phenylpropanoyl]oxy}-1,7-dihydroxy-9-oxo-5,20-epoxytax-11-en-2-yl benzoate |
| Paxceed |
| (2a,5b,7b,10b,13a)-4,10-bis(acetyloxy)-13-{[(2R,3S)-3-(benzoylamino)-2-hydroxy-3-phenylpropanoyl]oxy}-1,7-dihydroxy-9-oxo-5,20-epoxytax-11-en-2-yl benzoate |
| (2α,5β,7β,10β,13α)-4,10-Diacetoxy-13-{[(2R,3S)-3-(benzoylamino)-2-hydroxy-3-phenylpropanoyl]oxy}-1,7-dihydroxy-9-oxo-5,20-epoxytax-11-en-2-yl benzoate |
| 5b,20-Epoxy-1,2a,4,7b,10b,13a-hexahydroxytax-11-en-9-one 4,10-Diacetate 2-Benzoate 13-Ester with (2R,3S)-N-Benzoyl-3-phenylisoserine |
| Yewtaxan |
| Paclitaxel |
| TaxAlbin |
| Peclitaxel |
| Epitaxol |
| Taxol |
| (1S,2S,3R,4S,7R,9S,10S,12R,15S)-4,12-Bis(acetyloxy)-1,9-dihydroxy-15-({(2R,3S)-2-hydroxy-3-phenyl-3-[(phenylcarbonyl)amino]propanoyl}oxy)-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.0.0]heptadec-13-en-2-ylbenzolcarboxylat |
| Paxene |
| Taxol A |
| LipoPac |
| 7-Epi Paclitaxel |
| Ebetaxel |
| 7-epi-Taxol |
| (2α,5β,7β,10β,13α)-4,10-bis(acetyloxy)-1,7-dihydroxy-13-({(2R,3S)-2-hydroxy-3-phenyl-3-[(phenylcarbonyl)amino]propanoyl}oxy)-9-oxo-5,20-epoxytax-11-en-2-yl benzoate |
| Anzatax |
| UNII-P88XT4IS4D |
| baccatin III N-benzyl-b-phenylisoserine ester |
| (1S,2S,3R,4S,7R,9S,10S,12R,15S)-4,12-bis(acetyloxy)-1,9-dihydroxy-15-({(2R,3S)-2-hydroxy-3-phenyl-3-[(phenylcarbonyl)amino]propanoyl}oxy)-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.0.0]heptadec-13-en-2-yl benzoate |
| Onxol |