Boc-3-Hydroxy-1-adamantyl-D-glycine structure
|
Common Name | Boc-3-Hydroxy-1-adamantyl-D-glycine | ||
|---|---|---|---|---|
| CAS Number | 361442-00-4 | Molecular Weight | 325.400 | |
| Density | 1.296 | Boiling Point | 449.1±25.0 °C at 760 mmHg | |
| Molecular Formula | C17H27NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.4±23.2 °C | |
| Name | (2S)-2-((tert-Butoxycarbonyl)amino)-2-(3-hydroxyadamantan-1-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.296 |
|---|---|
| Boiling Point | 449.1±25.0 °C at 760 mmHg |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.400 |
| Flash Point | 225.4±23.2 °C |
| Exact Mass | 325.188934 |
| PSA | 95.86000 |
| LogP | 2.09 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.540 |
| InChIKey | UKCKDSNFBFHSHC-JGCLWBMSSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)C12CC3CC(CC(O)(C3)C1)C2 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924199090 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| BOC-L-SERINE T-BUTYLESTER |
| Boc-3-Hydroxy-1-adamantyl-D-glycine |
| L66 B6/B-H/DI A B- C 1B ITJ BYVQMVOX1&1&1 DQ &&S Form |
| Boc-L-Serine tert.butyl ester |
| Boc-3-Hydroxy-1-adamantyl-L-glycine |
| Glycine, N-[(1,1-dimethylethoxy)carbonyl]-, 3-hydroxytricyclo[3.3.1.1]dec-1-yl ester |
| (2S)-(3-Hydroxyadamantan-1-yl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid |
| 3-Hydroxyadamantan-1-yl N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate |
| (S)-N-Boc-3-hydroxyadamantylglycine |
| Boc-Ser-Otbu |