11-Keto-beta-boswellic acid structure
|
Common Name | 11-Keto-beta-boswellic acid | ||
|---|---|---|---|---|
| CAS Number | 17019-92-0 | Molecular Weight | 470.68400 | |
| Density | 1.14g/cm3 | Boiling Point | 591.8ºC at 760mmHg | |
| Molecular Formula | C30H46O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 325.8ºC | |
Use of 11-Keto-beta-boswellic acid11-Keto-beta-boswellic acid (11-Keto-β-boswellic acid) is a pentacyclic triterpenic acid of the oleogum resin from the bark of the Boswellia serrate tree, popularly known as Indian Frankincense. 11-Keto-beta-boswellic acid has the anti-inflammatory activity is primarily due to inhibit 5-lipoxygenase and subsequent leukotriene and nuclear factor-kappa B (NF-κB) activation and tumor necrosis factor alpha generation production[1]. |
| Name | 11-Keto β-Boswellic Acid |
|---|---|
| Synonym | More Synonyms |
| Description | 11-Keto-beta-boswellic acid (11-Keto-β-boswellic acid) is a pentacyclic triterpenic acid of the oleogum resin from the bark of the Boswellia serrate tree, popularly known as Indian Frankincense. 11-Keto-beta-boswellic acid has the anti-inflammatory activity is primarily due to inhibit 5-lipoxygenase and subsequent leukotriene and nuclear factor-kappa B (NF-κB) activation and tumor necrosis factor alpha generation production[1]. |
|---|---|
| Related Catalog | |
| Target |
NF-κB |
| References |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 591.8ºC at 760mmHg |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.68400 |
| Flash Point | 325.8ºC |
| Exact Mass | 470.34000 |
| PSA | 74.60000 |
| LogP | 6.26850 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | YIMHGPSYDOGBPI-UHFFFAOYSA-N |
| SMILES | CC1CCC2(C)CCC3(C)C(=CC(=O)C4C5(C)CCC(O)C(C)(C(=O)O)C5CCC43C)C2C1C |
| Storage condition | 2-8C |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 29189900 |
|
~%
11-Keto-beta-bo... CAS#:17019-92-0 |
| Literature: WO2006/95355 A1, ; Page/Page column 12 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 11-keto-beta-Boswellic acid |
| (3α,5ξ,9ξ,18ξ)-3-Hydroxy-11-oxours-12-en-24-oic acid |
| 11-KETO-β-BOSWELLIC ACID |