IFLAB-BB F2124-0140
Modify Date: 2025-09-05 11:54:08
IFLAB-BB F2124-0140 structure
|
Common Name | IFLAB-BB F2124-0140 | ||
|---|---|---|---|---|
| CAS Number | 54660-14-9 | Molecular Weight | 244.63500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9ClN4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(6-chloro-5-nitropyrimidin-4-yl)morpholine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H9ClN4O3 |
|---|---|
| Molecular Weight | 244.63500 |
| Exact Mass | 244.03600 |
| PSA | 84.07000 |
| LogP | 1.46300 |
| InChIKey | MIPDXPRZNICKKZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c(Cl)ncnc1N1CCOCC1 |
| HS Code | 2934999090 |
|---|
|
~%
IFLAB-BB F2124-0140 CAS#:54660-14-9 |
| Literature: Hull Journal of the Chemical Society, 1959 , p. 481,483 |
|
~%
IFLAB-BB F2124-0140 CAS#:54660-14-9 |
| Literature: Hull Journal of the Chemical Society, 1959 , p. 481,483 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:62063-02-9| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(6-chloro-5-nitro-pyrimidin-4-yl)-morpholine |
| 4-(6-Chlor-5-nitro-pyrimidin-4-yl)-morpholin |
| 4-Morpholino-5-nitro-6-chlorpyrimidin |
| 4-Morpholino-5-nitro-6-chloropyrimidine |