N-(4-Methylphenyl)sulfonylacetamide structure
|
Common Name | N-(4-Methylphenyl)sulfonylacetamide | ||
|---|---|---|---|---|
| CAS Number | 1888-33-1 | Molecular Weight | 213.25400 | |
| Density | 1.254 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H11NO3S | Melting Point | 140 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-Methylphenyl)sulfonylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.254 g/cm3 |
|---|---|
| Melting Point | 140 °C |
| Molecular Formula | C9H11NO3S |
| Molecular Weight | 213.25400 |
| Exact Mass | 213.04600 |
| PSA | 71.62000 |
| LogP | 2.29150 |
| Index of Refraction | 1.538 |
| InChIKey | BVJCFOOIOSGZFW-UHFFFAOYSA-N |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(C)cc1 |
| HS Code | 2935009090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
Name: Discovery of Small Molecules to Inhibit Human Cytomegalovirus Nuclear Egress
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: HCMV UL50
External Id: HMS1262
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| N-ethanoyl-4-methyl-benzenesulfonamide |
| N-Acetyl-p-toluene sulfonamide |
| N-p-tolylsulfonylacetamide |
| N-acetyl-4-toluenesulfonamide |
| T0400-0172 |