N(4), O(2')-dimethylcytidine structure
|
Common Name | N(4), O(2')-dimethylcytidine | ||
|---|---|---|---|---|
| CAS Number | 13048-95-8 | Molecular Weight | 271.27 | |
| Density | 1.54g/cm3 | Boiling Point | 475.4ºC at 760mmHg | |
| Molecular Formula | C11H17N3O5 | Melting Point | 203-205 °C | |
| MSDS | N/A | Flash Point | 241.3ºC | |
Use of N(4), O(2')-dimethylcytidineN4-Methyl-2’-O-methyl-cytidine is a purine nucleoside analogue. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
| Name | 1-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-4-(methylamino)pyrimidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | N4-Methyl-2’-O-methyl-cytidine is a purine nucleoside analogue. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 475.4ºC at 760mmHg |
| Melting Point | 203-205 °C |
| Molecular Formula | C11H17N3O5 |
| Molecular Weight | 271.27 |
| Flash Point | 241.3ºC |
| Exact Mass | 271.11700 |
| PSA | 109.33000 |
| Vapour Pressure | 4.91E-11mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | BNXGRQLXOMSOMV-PEBGCTIMSA-N |
| SMILES | CNc1ccn(C2OC(CO)C(O)C2OC)c(=O)n1 |
| Hazard Codes | Xn |
|---|
| N,2'-O-Dimethylcytidine |
| Cytidine,N-methyl-2'-O-methyl |
| N4,O2'-Dimethylcytidin |
| N4,2'-O-dimethylcytidine |
| N4-Methyl-2'-O-methyl-cytidin |
| N4,O2'-dimethyl-cytidine |