| Name | pheophorbide a |
|---|---|
| Synonyms |
Inchi=1/C35H36N4o5/C1-8-19-15(3)22-12-24-17(5)21(10-11-28(40)41)32(38-24)30-31(35(43)44-7)34(42)29-18(6)25(39-33(29)30)14-27-20(9-2)16(4)23(37-27)13-26(19)36-22/H8,12-14,17,21,31,36,39H,1,9-11H2,2-7H3,(H,40,41)/B22-12-,23-13-,24-12-,25-14-,26-13-,27-14
3-[(3S,4S,21R)-9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxophorbin-3-yl]propanoic acid EINECS 239-738-5 [3s-(3alpha,4beta,21beta)]-ramethyl-20-oxo 3-phorbinepropanoicacid,9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tet 13-Epi-phaeophorbide-a Rel-3-[(3R,4R)-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-9-vinylphorbin-3-yl]propanoic acid 3-[(3S,4S,21R)-14-Ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-9-vinylphorbin-3-yl]propanoic acid 3-Phorbinepropanoic acid,9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-,(3S,4S) [3S-(3alpha,4beta,21beta)]-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-9-vinylphorbine-3-propionic acid (3S,4S)-9-Ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoic acid Pheophorbide A (3S-(3a,4b,21b))-14-Ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-9-vinylphorbine-3-propionic Acid 3-[(3S,4S,21R)-14-Ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-9-vinyl-3-phorbinyl]propanoic acid Demagnesia chloric acid -a |
| Description | Pheophorbide A is an intermediate product in the chlorophyll degradation pathway and can be used as a photosensitizer. Pheophorbide A acts as a lymphovascular activator with antitumor activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 1019.0±65.0 °C at 760 mmHg |
| Melting Point | 191-195°C (lit.) |
| Molecular Formula | C35H36N4O5 |
| Molecular Weight | 592.68 |
| Flash Point | 570.1±34.3 °C |
| Exact Mass | 592.268555 |
| PSA | 136.97000 |
| LogP | 6.76 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.630 |
| Hazard Codes | Xn |
|---|---|
| RIDADR | NONH for all modes of transport |