| Name | bicyclo[3.3.1]nonan-9-one | 
|---|---|
| Synonyms | 
                                
                                EINECS 241-868-2
                                
                                
                                 Bicyclo(3.3.1)nonan-9-one MFCD00074752 bicyclo[3.3.1]nonane-9-one 9-ketobicyclo[3.3.1]nonane Bicyclo[3.3.1]nona-9-one Bicyclo[3.3.1]nonan-9-one  | 
                        
| Density | 1.007g/cm3 | 
|---|---|
| Boiling Point | 219.8ºC at 760mmHg | 
| Melting Point | 155-157ºC(lit.) | 
| Molecular Formula | C9H14O | 
| Molecular Weight | 138.20700 | 
| Flash Point | 79.6ºC | 
| Exact Mass | 138.10400 | 
| PSA | 17.07000 | 
| LogP | 2.15570 | 
| Vapour Pressure | 0.117mmHg at 25°C | 
| Index of Refraction | 1.49 | 
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter | 
|---|---|
| Hazard Codes | Xi: Irritant; | 
| Risk Phrases | 36/37/38 | 
| Safety Phrases | S24/25 | 
| RIDADR | NONH for all modes of transport | 
| HS Code | 2914299000 | 
| Precursor 6 | |
|---|---|
| DownStream 5 | |
| HS Code | 2914299000 | 
|---|---|
| Summary | 2914299000. other cyclanic, cyclenic or cyclotherpenic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |