bicyclo[3.3.1]nonan-9-one
Modify Date: 2025-08-25 14:10:49
![bicyclo[3.3.1]nonan-9-one Structure](https://image.chemsrc.com/caspic/099/17931-55-4.png)
bicyclo[3.3.1]nonan-9-one structure
|
Common Name | bicyclo[3.3.1]nonan-9-one | ||
|---|---|---|---|---|
| CAS Number | 17931-55-4 | Molecular Weight | 138.20700 | |
| Density | 1.007g/cm3 | Boiling Point | 219.8ºC at 760mmHg | |
| Molecular Formula | C9H14O | Melting Point | 155-157ºC(lit.) | |
| MSDS | USA | Flash Point | 79.6ºC | |
| Name | bicyclo[3.3.1]nonan-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.007g/cm3 |
|---|---|
| Boiling Point | 219.8ºC at 760mmHg |
| Melting Point | 155-157ºC(lit.) |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.20700 |
| Flash Point | 79.6ºC |
| Exact Mass | 138.10400 |
| PSA | 17.07000 |
| LogP | 2.15570 |
| Vapour Pressure | 0.117mmHg at 25°C |
| Index of Refraction | 1.49 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2914299000 |
| Precursor 6 | |
|---|---|
| DownStream 5 | |
CAS#:1552-12-1![Bicyclo[3.3.1]nonan-9-ol,9-pentyl- Structure](https://image.chemsrc.com/caspic/459/21914-97-6.png)
CAS#:21914-97-6
CAS#:109-53-5![Δ2-Bicyclo[3.3.1]nonen-9-on-oxim Structure](https://image.chemsrc.com/caspic/182/27591-27-1.png)
CAS#:27591-27-1![bicyclo[3.3.1]nonan-9-ol Structure](https://image.chemsrc.com/caspic/400/15598-80-8.png)
CAS#:15598-80-8
CAS#:10468-37-8![Bicyclo[3.3.1]nonan-9-ol,9-cyclohexyl- structure](https://image.chemsrc.com/caspic/424/21915-40-2.png)
CAS#:21915-40-2![N-(9-bicyclo[3.3.1]nonanylidene)hydroxylamine structure](https://image.chemsrc.com/caspic/324/29238-88-8.png)
CAS#:29238-88-8![9-methylbicyclo[3.3.1]nonane structure](https://image.chemsrc.com/caspic/289/25107-01-1.png)
CAS#:25107-01-1![9-prop-2-enylbicyclo[3.3.1]nonan-9-ol structure](https://image.chemsrc.com/caspic/467/61967-27-9.png)
CAS#:61967-27-9| HS Code | 2914299000 |
|---|---|
| Summary | 2914299000. other cyclanic, cyclenic or cyclotherpenic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|
Carbon-13 NMR spectra of solid bicyclo [3. 3. 1] nonan-9-one. Conformational studies in the solid state. Wasylishen RE and Friesen KJ.
Org. Magn. Reson. 13(5) , 343-44, (1980)
|
|
|
Proximity Effects. XLIII. The Solvolysis of 4-Cyclooctene-1-methyl Brosylate1, 2 Cope AC, et al.
J. Am. Chem. Soc. 87(14) , 3130-35, (1965)
|
| EINECS 241-868-2 |
| Bicyclo(3.3.1)nonan-9-one |
| MFCD00074752 |
| bicyclo[3.3.1]nonane-9-one |
| 9-ketobicyclo[3.3.1]nonane |
| Bicyclo[3.3.1]nona-9-one |
| Bicyclo[3.3.1]nonan-9-one |