| Name | 3-methylbutyl(triphenyl)phosphanium,bromide | 
|---|---|
| Synonyms | ISOAMYLTRIPHENYLPHOSPHONIUM BROMIDE (3-Methylbutyl)triphenylphosphonium bromide isoamyl triphenylphosphonium bromide EINECS 248-966-4 MFCD00031594 3-methyl-1-butanetriphenylphosphonium bromide 3-methylbutyl(triphenyl)phosphanium bromide Isopentyltriphenylphosphonium bromide Ph3P(+)CH2CH2CH(CH3)2Br(-) 3-methylbutyltriphenylphosphonium bromide | 
| Melting Point | 157-159 °C(lit.) | 
|---|---|
| Molecular Formula | C23H26BrP | 
| Molecular Weight | 413.33000 | 
| Exact Mass | 412.09600 | 
| PSA | 13.59000 | 
| LogP | 2.03060 | 
| Symbol |   GHS07 | 
|---|---|
| Signal Word | Warning | 
| Hazard Statements | H315-H319-H335 | 
| Precautionary Statements | P261-P305 + P351 + P338 | 
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves | 
| Hazard Codes | Xi: Irritant; | 
| Risk Phrases | R36/37/38 | 
| Safety Phrases | S26-S37/39 | 
| RIDADR | NONH for all modes of transport | 
| WGK Germany | 3 | 
| HS Code | 2931900090 | 
| ~95%   28322-40-9 | 
| Literature: Buss, Antony D.; Warren, Stuart Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 2307 - 2326 | 
| Precursor 2 | |
|---|---|
| DownStream 7 | |
| HS Code | 2931900090 | 
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |