28322-40-9
28322-40-9 structure
- Name: isoamyltriphenylphosphonium bromide
- Chemical Name: 3-methylbutyl(triphenyl)phosphanium,bromide
- CAS Number: 28322-40-9
- Molecular Formula: C23H26BrP
- Molecular Weight: 413.33000
- Create Date: 2018-05-10 08:00:00
- Modify Date: 2024-01-08 15:55:55
| Name | 3-methylbutyl(triphenyl)phosphanium,bromide |
|---|---|
| Synonyms |
ISOAMYLTRIPHENYLPHOSPHONIUM BROMIDE
(3-Methylbutyl)triphenylphosphonium bromide isoamyl triphenylphosphonium bromide EINECS 248-966-4 MFCD00031594 3-methyl-1-butanetriphenylphosphonium bromide 3-methylbutyl(triphenyl)phosphanium bromide Isopentyltriphenylphosphonium bromide Ph3P(+)CH2CH2CH(CH3)2Br(-) 3-methylbutyltriphenylphosphonium bromide |
| Melting Point | 157-159 °C(lit.) |
|---|---|
| Molecular Formula | C23H26BrP |
| Molecular Weight | 413.33000 |
| Exact Mass | 412.09600 |
| PSA | 13.59000 |
| LogP | 2.03060 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2931900090 |
|
~95%
28322-40-9 |
| Literature: Buss, Antony D.; Warren, Stuart Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 2307 - 2326 |
| Precursor 2 | |
|---|---|
| DownStream 7 | |
![[3-methylbutyl(phenyl)phosphoryl]benzene structure](https://image.chemsrc.com/caspic/482/46941-66-6.png)
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |