isoamyltriphenylphosphonium bromide
Modify Date: 2024-01-08 15:55:55
isoamyltriphenylphosphonium bromide structure
|
Common Name | isoamyltriphenylphosphonium bromide | ||
|---|---|---|---|---|
| CAS Number | 28322-40-9 | Molecular Weight | 413.33000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H26BrP | Melting Point | 157-159 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-methylbutyl(triphenyl)phosphanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 157-159 °C(lit.) |
|---|---|
| Molecular Formula | C23H26BrP |
| Molecular Weight | 413.33000 |
| Exact Mass | 412.09600 |
| PSA | 13.59000 |
| LogP | 2.03060 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2931900090 |
|
~95%
isoamyltripheny... CAS#:28322-40-9 |
| Literature: Buss, Antony D.; Warren, Stuart Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 2307 - 2326 |
| Precursor 2 | |
|---|---|
| DownStream 7 | |
CAS#:21834-92-4
CAS#:102803-59-8
CAS#:75853-51-9
CAS#:89091-85-0
CAS#:92168-98-4![[3-methylbutyl(phenyl)phosphoryl]benzene structure](https://www.chemsrc.com/caspic/482/46941-66-6.png)
CAS#:46941-66-6
CAS#:39110-24-2| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| ISOAMYLTRIPHENYLPHOSPHONIUM BROMIDE |
| (3-Methylbutyl)triphenylphosphonium bromide |
| isoamyl triphenylphosphonium bromide |
| EINECS 248-966-4 |
| MFCD00031594 |
| 3-methyl-1-butanetriphenylphosphonium bromide |
| 3-methylbutyl(triphenyl)phosphanium bromide |
| Isopentyltriphenylphosphonium bromide |
| Ph3P(+)CH2CH2CH(CH3)2Br(-) |
| 3-methylbutyltriphenylphosphonium bromide |