16135-32-3
16135-32-3 structure
- Name: Formamide,N-(2-chloro-4-nitrophenyl)-
- Chemical Name: N-(2-chloro-4-nitrophenyl)formamide
- CAS Number: 16135-32-3
- Molecular Formula: C7H5ClN2O3
- Molecular Weight: 200.57900
- Create Date: 2017-01-22 10:12:12
- Modify Date: 2023-01-17 20:49:36
| Name | N-(2-chloro-4-nitrophenyl)formamide |
|---|---|
| Synonyms |
2'-Chlor-4'-nitroformanilid
2-chloro-4-nitroformanilide Formamide,N-(2-chloro-4-nitrophenyl) |
| Density | 1.542g/cm3 |
|---|---|
| Boiling Point | 416.5ºC at 760mmHg |
| Molecular Formula | C7H5ClN2O3 |
| Molecular Weight | 200.57900 |
| Flash Point | 205.7ºC |
| Exact Mass | 199.99900 |
| PSA | 74.92000 |
| LogP | 3.04860 |
| Vapour Pressure | 3.8E-07mmHg at 25°C |
| Index of Refraction | 1.651 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |