Formamide,N-(2-chloro-4-nitrophenyl)- structure
|
Common Name | Formamide,N-(2-chloro-4-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 16135-32-3 | Molecular Weight | 200.57900 | |
| Density | 1.542g/cm3 | Boiling Point | 416.5ºC at 760mmHg | |
| Molecular Formula | C7H5ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.7ºC | |
| Name | N-(2-chloro-4-nitrophenyl)formamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.542g/cm3 |
|---|---|
| Boiling Point | 416.5ºC at 760mmHg |
| Molecular Formula | C7H5ClN2O3 |
| Molecular Weight | 200.57900 |
| Flash Point | 205.7ºC |
| Exact Mass | 199.99900 |
| PSA | 74.92000 |
| LogP | 3.04860 |
| Vapour Pressure | 3.8E-07mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | MYCMEGWPQLBYIA-UHFFFAOYSA-N |
| SMILES | O=CNc1ccc([N+](=O)[O-])cc1Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2'-Chlor-4'-nitroformanilid |
| 2-chloro-4-nitroformanilide |
| Formamide,N-(2-chloro-4-nitrophenyl) |