Bis(trimethylsilyl)carbodiimide structure
|
Common Name | Bis(trimethylsilyl)carbodiimide | ||
|---|---|---|---|---|
| CAS Number | 1000-70-0 | Molecular Weight | 186.402 | |
| Density | 0.8±0.1 g/cm3 | Boiling Point | 165.8±9.0 °C at 760 mmHg | |
| Molecular Formula | C7H18N2Si2 | Melting Point | −23 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 54.1±18.7 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
| Name | Bis(trimethylsilyl)carbodiimide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 165.8±9.0 °C at 760 mmHg |
| Melting Point | −23 °C(lit.) |
| Molecular Formula | C7H18N2Si2 |
| Molecular Weight | 186.402 |
| Flash Point | 54.1±18.7 °C |
| Exact Mass | 186.100845 |
| PSA | 24.72000 |
| LogP | 4.09 |
| Vapour Pressure | 2.4±0.3 mmHg at 25°C |
| Index of Refraction | 1.424 |
| InChIKey | KSVMTHKYDGMXFJ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N=C=N[Si](C)(C)C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H302-H315-H319-H335 |
| Precautionary Statements | P210-P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R10;R22;R36/37/38 |
| Safety Phrases | S26-S36-S37/39-S16 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| RTECS | VV1302500 |
| Packaging Group | III |
| Hazard Class | 3 |
| HS Code | 2931900090 |
| Precursor 9 | |
|---|---|
| DownStream 7 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
A. Aumüller, S. Hünig
Angew. Chem. Int. Ed. Engl. 96 , 437, (1984)
|
|
|
Liebigs Ann. Chem. , 142, (1986)
|
|
|
Synthetic Metals 64 , 83, (1994)
|
| carbodiimide, bis(trimethylsilyl)- |
| EINECS 213-673-2 |
| MFCD00051538 |
| 1,3-Bis(trimethylsilyl)carbodiimide |
| N,N'-Methanediylidenebis(1,1,1-trimethylsilanamine) |
| Bis(triMethylsilyl)carbodiiMide |
| N,N'-Bis(trimethylsilyl)carbodiimide |
| Silanamine, N,N'-methanetetraylbis[1,1,1-trimethyl- |
| N,N'-bis(trimethylsilyl)methanediimine |
| Silanamine, 1,1,1-trimethyl-N-[(trimethylsilyl)carbonimidoyl]- |
| N,N-Bis(trimethylsilyl)carbodiimide |