THPN structure
|
Common Name | THPN | ||
|---|---|---|---|---|
| CAS Number | 100079-26-3 | Molecular Weight | 266.33300 | |
| Density | 1.148g/cm3 | Boiling Point | 483.5ºC at 760mmHg | |
| Molecular Formula | C15H22O4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 260.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of THPNTHPN is a potent Nur77 agonist. THPN specifically binds the LBD of Nur77 (TR3) but not that of retinoic acid receptor α and PPARγ with a Kd of 270 nM. THPN leads to Nur77 translocation to the mitochondria to induce autophagic cell death in melanoma[1][2]. |
| Name | 1-(3,4,5-trihydroxyphenyl)nonan-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | THPN is a potent Nur77 agonist. THPN specifically binds the LBD of Nur77 (TR3) but not that of retinoic acid receptor α and PPARγ with a Kd of 270 nM. THPN leads to Nur77 translocation to the mitochondria to induce autophagic cell death in melanoma[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.148g/cm3 |
|---|---|
| Boiling Point | 483.5ºC at 760mmHg |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.33300 |
| Flash Point | 260.3ºC |
| Exact Mass | 266.15200 |
| PSA | 77.76000 |
| LogP | 3.73670 |
| Vapour Pressure | 5.69E-10mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | NVFRHTFJDGAFQS-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(=O)c1cc(O)c(O)c(O)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Precautionary Statements | P301 + P312 + P330 |
| Hazard Codes | Xn |
| RIDADR | NONH for all modes of transport |
|
Impeding the interaction between Nur77 and p38 reduces LPS-induced inflammation. Li L et al
Nat. Chem. Biol. 11(5) , 339-46, (2015)
|
| 1-(3,4,5)-Trihydroxyphenyl)nonan-1-one |
| 1-(2,4,6-Trihydroxyphenyl)-1-nonanone |
| 1-Nonanone,1-(2,4,6-trihydroxyphenyl) |
| 1,2,3-Benzenetriol,4-(octylcarbonyl) |
| T94 |