N-Ethyl-2-fluoro-N-(1-naphtyl)acetamide structure
|
Common Name | N-Ethyl-2-fluoro-N-(1-naphtyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 10016-03-2 | Molecular Weight | 231.26500 | |
| Density | 1.173g/cm3 | Boiling Point | 359.9ºC at 760 mmHg | |
| Molecular Formula | C14H14FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.5ºC | |
| Name | N-ethyl-2-fluoro-N-naphthalen-1-ylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 359.9ºC at 760 mmHg |
| Molecular Formula | C14H14FNO |
| Molecular Weight | 231.26500 |
| Flash Point | 171.5ºC |
| Exact Mass | 231.10600 |
| PSA | 20.31000 |
| LogP | 3.16220 |
| Vapour Pressure | 2.3E-05mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | CRIRLEILQZHEPZ-UHFFFAOYSA-N |
| SMILES | CCN(C(=O)CF)c1cccc2ccccc12 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-(N-Aethyl-2-fluoracetamido)naphthalin |
| LS-9549 |
| ACETAMIDE,N-ETHYL-2-FLUORO-N-1-NAPHTHYL |
| N-ethyl-2-fluoro-N-(naphthalen-1-yl)acetamide |
| N-Ethyl-2-fluoro-N-1-naphthylacetamide |