3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine
![3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine Structure](https://image.chemsrc.com/caspic/188/100240-32-2.png)
3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine structure
|
Common Name | 3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine | ||
|---|---|---|---|---|
| CAS Number | 100240-32-2 | Molecular Weight | 292.73900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14ClFN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H14ClFN4 |
|---|---|
| Molecular Weight | 292.73900 |
| Exact Mass | 292.08900 |
| PSA | 32.26000 |
| LogP | 2.72570 |
| InChIKey | QEOKQYCZZXYXCY-UHFFFAOYSA-N |
| SMILES | Fc1ccccc1N1CCN(c2ccc(Cl)nn2)CC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~77%
3-chloro-6-[4-(... CAS#:100240-32-2 |
| Literature: Janssen Pharmaceutica N.V. Patent: US5001125 A1, 1991 ; |
|
~74%
3-chloro-6-[4-(... CAS#:100240-32-2 |
| Literature: JANSSEN PHARMACEUTICA N.V. Patent: EP156433 B1, 1991 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-chloro-6-[4-(2-fluorophenyl)-1-piperazinyl]pyridazine |
| Pyridazine,3-chloro-6-[4-(2-fluorophenyl)-1-piperazinyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine? |
| A: SMILES notation of 3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine is Fc1ccccc1N1CCN(c2ccc(Cl)nn2)CC1. |
| Q: What is the Chinese name of 100240-32-2? |
| A: Chinese name of 100240-32-2 is 100240-32-2. |
| Q: What is the molecular formula of 3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine? |
| A: Molecular formula of 3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine is C14H14ClFN4. |
| Q: What is the English name of 3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine? |
| A: The English name of 3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine is 3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine. |
| Q: What is the LogP of 3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine? |
| A: LogP of 3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine is 2.72570. |
| Q: What English synonyms does 3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine have? |
| A: English synonyms of 3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine: 3-chloro-6-[4-(2-fluorophenyl)-1-piperazinyl]pyridazine, Pyridazine,3-chloro-6-[4-(2-fluorophenyl)-1-piperazinyl]. |
| Q: What is the CAS number of 3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine? |
| A: CAS number of 3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine is 100240-32-2. |
| Q: What is the InChIKey of 3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine? |
| A: InChIKey of 3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine is QEOKQYCZZXYXCY-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine? |
| A: Molecular weight of 3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine is 292.73900. |
| Q: What is the polar surface area (PSA) of 3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine? |
| A: Polar surface area (PSA) of 3-chloro-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine is 32.26000. |