N-tert-Butyl-2-thiophenesulfonamide structure
|
Common Name | N-tert-Butyl-2-thiophenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 100342-30-1 | Molecular Weight | 219.324 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 320.8±34.0 °C at 760 mmHg | |
| Molecular Formula | C8H13NO2S2 | Melting Point | 82.0 to 86.0 °C | |
| MSDS | N/A | Flash Point | 147.8±25.7 °C | |
| Name | N-tert-Butyl-2-thiophenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 320.8±34.0 °C at 760 mmHg |
| Melting Point | 82.0 to 86.0 °C |
| Molecular Formula | C8H13NO2S2 |
| Molecular Weight | 219.324 |
| Flash Point | 147.8±25.7 °C |
| Exact Mass | 219.038773 |
| PSA | 82.79000 |
| LogP | 1.80 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | CLKMBGGZGFULOO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)c1cccs1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2935009090 |
|
~96%
N-tert-Butyl-2-... CAS#:100342-30-1 |
| Literature: Alcon Laboratories, Inc. Patent: US5153192 A1, 1992 ; |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 2-Thiophenesulfonamide, N-(1,1-dimethylethyl)- |
| N-(2-Methyl-2-propanyl)-2-thiophenesulfonamide |
| N-tert-Butylthiophene-2-sulfonamide |
| Thiophene-2-sulfonic acid tert-butylamide |
| 2-(tert-Butylaminosulfonyl)thiophene |
| N-tert-Butyl-2-thiophenesulfonamide |