Benzene,[dichloro[(phenylmethyl)sulfonyl]methyl]- structure
|
Common Name | Benzene,[dichloro[(phenylmethyl)sulfonyl]methyl]- | ||
|---|---|---|---|---|
| CAS Number | 10038-08-1 | Molecular Weight | 315.21500 | |
| Density | 1.384g/cm3 | Boiling Point | 475.3ºC at 760mmHg | |
| Molecular Formula | C14H12Cl2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.3ºC | |
| Name | [dichloro(phenyl)methyl]sulfonylmethylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.384g/cm3 |
|---|---|
| Boiling Point | 475.3ºC at 760mmHg |
| Molecular Formula | C14H12Cl2O2S |
| Molecular Weight | 315.21500 |
| Flash Point | 241.3ºC |
| Exact Mass | 313.99400 |
| PSA | 42.52000 |
| LogP | 4.97030 |
| Vapour Pressure | 9.62E-09mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | MTTPKLOSMYAEAE-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cc1ccccc1)C(Cl)(Cl)c1ccccc1 |
| HS Code | 2904909090 |
|---|
|
~%
Benzene,[dichlo... CAS#:10038-08-1 |
| Literature: Journal of the American Chemical Society, , vol. 93, p. 476 - 484 |
|
~%
Benzene,[dichlo... CAS#:10038-08-1 |
| Literature: Journal of the American Chemical Society, , vol. 93, p. 476 - 484 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| (benzylsulfonyl-dichloro-methyl)benzene |