Benzene,[chloro[(phenylmethyl)sulfonyl]methyl]-
Modify Date: 2025-08-21 00:00:54
![Benzene,[chloro[(phenylmethyl)sulfonyl]methyl]- Structure](https://image.chemsrc.com/caspic/143/6668-15-1.png)
Benzene,[chloro[(phenylmethyl)sulfonyl]methyl]- structure
|
Common Name | Benzene,[chloro[(phenylmethyl)sulfonyl]methyl]- | ||
|---|---|---|---|---|
| CAS Number | 6668-15-1 | Molecular Weight | 280.77000 | |
| Density | 1.299g/cm3 | Boiling Point | 469.8ºC at 760mmHg | |
| Molecular Formula | C14H13ClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [chloro(phenyl)methyl]sulfonylmethylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.299g/cm3 |
|---|---|
| Boiling Point | 469.8ºC at 760mmHg |
| Molecular Formula | C14H13ClO2S |
| Molecular Weight | 280.77000 |
| Exact Mass | 280.03200 |
| PSA | 42.52000 |
| LogP | 4.61980 |
| Index of Refraction | 1.604 |
| InChIKey | SJMMZFZYGOFEGI-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cc1ccccc1)C(Cl)c1ccccc1 |
|
~%
Benzene,[chloro... CAS#:6668-15-1 |
| Literature: Cinquini,M.; Colonna,S. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1972 , p. 1883 - 1886 |
|
~%
Benzene,[chloro... CAS#:6668-15-1 |
| Literature: Cinquini,M.; Colonna,S. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1972 , p. 1883 - 1886 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| [(benzylsulfanyl)(chloro)methyl]benzene |
| Benzene,[chloro[(phenylmethyl)thio]methyl] |