5-[(4-dimethylaminophenyl)methylidene]imidazolidine-2,4-dione structure
|
Common Name | 5-[(4-dimethylaminophenyl)methylidene]imidazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 10040-87-6 | Molecular Weight | 231.25100 | |
| Density | 1.287g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5Z)-5-[[4-(dimethylamino)phenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.287g/cm3 |
|---|---|
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25100 |
| Exact Mass | 231.10100 |
| PSA | 61.44000 |
| LogP | 1.59050 |
| Index of Refraction | 1.653 |
| InChIKey | KLVRHZIOWMWJOC-JXMROGBWSA-N |
| SMILES | CN(C)c1ccc(C=C2NC(=O)NC2=O)cc1 |
|
~80%
5-[(4-dimethyla... CAS#:10040-87-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 55, # 2 p. 743 - 753 |
|
~%
5-[(4-dimethyla... CAS#:10040-87-6 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 21, # 1 p. 135 - 145 |
| (5Z)-5-(4-(dimethylamino)benzylidene)imidazolidine-2,4-dione |
| (5E)-5-(4-aminobenzylidene)-2-thioxo-1,3-thiazolidin-4-one |
| (Z)-5-(4-aminobenzylidene)-2-thioxothiazolidin-4-one |
| (Z)-5-(4-dimethylaminobenzylidene)hydantoin |
| 5-(4-Amino-benzyliden)-2-thioxo-thiazolidin-4-on |
| (5Z)-5-(4-aminobenzylidene)-2-thioxothiazolidin-4-one |
| (Z)-5-(4-dimethylaminobenzylidene)imidazolidine-2,4-dione |
| 4-Thiazolidinone,5-[(4-aminophenyl)methylene]-2-thioxo |
| 5-(4-amino-benzylidene)-2-thioxo-thiazolidin-4-one |