5-(4-dimethylaminobenzyl)imidazolidine-2,4-dione structure
|
Common Name | 5-(4-dimethylaminobenzyl)imidazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 58841-92-2 | Molecular Weight | 233.26600 | |
| Density | 1.227g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[[4-(dimethylamino)phenyl]methyl]imidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.227g/cm3 |
|---|---|
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.26600 |
| Exact Mass | 233.11600 |
| PSA | 68.42000 |
| LogP | 0.41900 |
| Index of Refraction | 1.591 |
| InChIKey | IWMOQPPEWPBOKP-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(CC2NC(=O)NC2=O)cc1 |
|
~48%
5-(4-dimethylam... CAS#:58841-92-2 |
| Literature: Wessels; Schwan; Pong Journal of Pharmaceutical Sciences, 1980 , vol. 69, # 9 p. 1102 - 1104 |
|
~%
5-(4-dimethylam... CAS#:58841-92-2 |
| Literature: Wessels; Schwan; Pong Journal of Pharmaceutical Sciences, 1980 , vol. 69, # 9 p. 1102 - 1104 |
| 5-(4-Dimethylaminobenzyl)imidazolidine-2,4-dione |
| 5-(P-dimethylaminobenzyl) hydantoin |
| 5-Dmabid |