1,4-Naphthalenedione,5,8-dimethoxy- structure
|
Common Name | 1,4-Naphthalenedione,5,8-dimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 15013-16-8 | Molecular Weight | 218.20500 | |
| Density | 1.279g/cm3 | Boiling Point | 415.4ºC at 760mmHg | |
| Molecular Formula | C12H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.8ºC | |
| Name | 5,8-dimethoxynaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.279g/cm3 |
|---|---|
| Boiling Point | 415.4ºC at 760mmHg |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.20500 |
| Flash Point | 188.8ºC |
| Exact Mass | 218.05800 |
| PSA | 52.60000 |
| LogP | 1.63900 |
| Vapour Pressure | 4.13E-07mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | HXULXWJWZVUESP-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c2c1C(=O)C=CC2=O |
| HS Code | 2914690090 |
|---|
|
~95%
1,4-Naphthalene... CAS#:15013-16-8 |
| Literature: Tanoue, Yasuhiro; Sakata, Kazunori; Hashimoto, Mamoru; Morishita, Shin-ichi; Hamada, Moritsugu Bulletin of the Chemical Society of Japan, 1994 , vol. 67, # 9 p. 2593 - 2595 |
|
~78%
1,4-Naphthalene... CAS#:15013-16-8 |
| Literature: Arima; Yamada; Takeda; Takayanagi; Harigaya Chemical and Pharmaceutical Bulletin, 2001 , vol. 49, # 10 p. 1340 - 1342 |
|
~9%
1,4-Naphthalene... CAS#:15013-16-8 |
| Literature: Smith, Thomas H.; Wu, Helen Y. Journal of Organic Chemistry, 1982 , vol. 47, # 10 p. 1974 - 1976 |
|
~%
1,4-Naphthalene... CAS#:15013-16-8 |
| Literature: Brass; Pfluger; Honsberg Chemische Berichte, 1936 , vol. 69, p. 80,87 |
|
~%
1,4-Naphthalene... CAS#:15013-16-8 |
| Literature: Cameron, Donald W.; Feutrill, Geoffrey I.; McKay, Peter G. Australian Journal of Chemistry, 1982 , vol. 35, # 10 p. 2095 - 2109 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914690090 |
|---|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| naphthazarin |
| 5,8-Dimethoxy-[1,4]naphthochinon |
| 1,4-Naphthoquinone,5,8-dimethoxy |
| 1,5,8-dimethoxy |
| 5,8-dimethoxy-naphthalene-1,4-dione |
| 5,8-dimethoxy-1,4-naphthoquinone |
| 5,8-di-O-methylnaphthazarin |
| 5,8-dimethoxynaphthoquinone |
| 1,4-Naphthalenedione,5,8-dimethoxy |