6-ethoxycarbonyl-2,3-dimethoxybenzoate structure
|
Common Name | 6-ethoxycarbonyl-2,3-dimethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 123796-70-3 | Molecular Weight | 253.22800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-ethoxycarbonyl-2,3-dimethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13O6 |
|---|---|
| Molecular Weight | 253.22800 |
| Exact Mass | 253.07100 |
| PSA | 84.89000 |
| LogP | 0.24400 |
| InChIKey | YSSRAFLMFRNXKL-UHFFFAOYSA-M |
| SMILES | CCOC(=O)c1ccc(OC)c(OC)c1C(=O)[O-] |
|
~%
6-ethoxycarbony... CAS#:123796-70-3 |
| Literature: Monatshefte fuer Chemie, , vol. 16, p. 114,128 |
|
~%
6-ethoxycarbony... CAS#:123796-70-3 |
| Literature: Monatshefte fuer Chemie, , vol. 16, p. 116,131 |
|
~%
6-ethoxycarbony... CAS#:123796-70-3 |
| Literature: Monatshefte fuer Chemie, , vol. 16, p. 114,128 |
|
~%
6-ethoxycarbony... CAS#:123796-70-3 |
| Literature: Journal of the Chemical Society, , p. 1030,1033 |
| 1,2-Benzenedicarboxylic acid,3,4-dimethoxy-,2-ethyl ester |
| 2-(ethoxycarbonyl)-3,4-dimethoxybenzoic acid |
| 3,4-dimethoxy-phthalic acid-2-ethyl ester |
| 3,4-dimethoxy-2-carbethoxybenzoic acid |
| 3,4-Dimethoxy-phthalsaeure-2-aethylester |
| Hemipinsaeure-aethylester-(2) |