6-ethoxycarbonyl-2,3-dimethoxybenzoate
6-ethoxycarbonyl-2,3-dimethoxybenzoate structure
|
Common Name | 6-ethoxycarbonyl-2,3-dimethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 123796-70-3 | Molecular Weight | 253.22800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-ethoxycarbonyl-2,3-dimethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13O6 |
|---|---|
| Molecular Weight | 253.22800 |
| Exact Mass | 253.07100 |
| PSA | 84.89000 |
| LogP | 0.24400 |
| InChIKey | YSSRAFLMFRNXKL-UHFFFAOYSA-M |
| SMILES | CCOC(=O)c1ccc(OC)c(OC)c1C(=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
6-ethoxycarbony... CAS#:123796-70-3 |
| Literature: Monatshefte fuer Chemie, , vol. 16, p. 114,128 |
|
~%
6-ethoxycarbony... CAS#:123796-70-3 |
| Literature: Monatshefte fuer Chemie, , vol. 16, p. 116,131 |
|
~%
6-ethoxycarbony... CAS#:123796-70-3 |
| Literature: Monatshefte fuer Chemie, , vol. 16, p. 114,128 |
|
~%
6-ethoxycarbony... CAS#:123796-70-3 |
| Literature: Journal of the Chemical Society, , p. 1030,1033 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 2 | |
CAS#:4667-74-7
CAS#:4741-58-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,2-Benzenedicarboxylic acid,3,4-dimethoxy-,2-ethyl ester |
| 2-(ethoxycarbonyl)-3,4-dimethoxybenzoic acid |
| 3,4-dimethoxy-phthalic acid-2-ethyl ester |
| 3,4-dimethoxy-2-carbethoxybenzoic acid |
| 3,4-Dimethoxy-phthalsaeure-2-aethylester |
| Hemipinsaeure-aethylester-(2) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 6-ethoxycarbonyl-2,3-dimethoxybenzoate? |
| A: InChIKey of 6-ethoxycarbonyl-2,3-dimethoxybenzoate is YSSRAFLMFRNXKL-UHFFFAOYSA-M. |
| Q: What is the LogP of 6-ethoxycarbonyl-2,3-dimethoxybenzoate? |
| A: LogP of 6-ethoxycarbonyl-2,3-dimethoxybenzoate is 0.24400. |
| Q: What is the Chinese name of 123796-70-3? |
| A: Chinese name of 123796-70-3 is 123796-70-3. |
| Q: What is the polar surface area (PSA) of 6-ethoxycarbonyl-2,3-dimethoxybenzoate? |
| A: Polar surface area (PSA) of 6-ethoxycarbonyl-2,3-dimethoxybenzoate is 84.89000. |
| Q: What are the upstream materials of 6-ethoxycarbonyl-2,3-dimethoxybenzoate? |
| A: Related upstream materials(CAS) of 6-ethoxycarbonyl-2,3-dimethoxybenzoate: 104270-87-3;75-03-6;100973-01-1;1567-56-2;64-17-5. |
| Q: What is the SMILES notation of 6-ethoxycarbonyl-2,3-dimethoxybenzoate? |
| A: SMILES notation of 6-ethoxycarbonyl-2,3-dimethoxybenzoate is CCOC(=O)c1ccc(OC)c(OC)c1C(=O)[O-]. |
| Q: What is the molecular formula of 6-ethoxycarbonyl-2,3-dimethoxybenzoate? |
| A: Molecular formula of 6-ethoxycarbonyl-2,3-dimethoxybenzoate is C12H13O6. |
| Q: What is the CAS number of 6-ethoxycarbonyl-2,3-dimethoxybenzoate? |
| A: CAS number of 6-ethoxycarbonyl-2,3-dimethoxybenzoate is 123796-70-3. |
| Q: What is the English name of 6-ethoxycarbonyl-2,3-dimethoxybenzoate? |
| A: The English name of 6-ethoxycarbonyl-2,3-dimethoxybenzoate is 6-ethoxycarbonyl-2,3-dimethoxybenzoate. |
| Q: What English synonyms does 6-ethoxycarbonyl-2,3-dimethoxybenzoate have? |
| A: English synonyms of 6-ethoxycarbonyl-2,3-dimethoxybenzoate: 1,2-Benzenedicarboxylic acid,3,4-dimethoxy-,2-ethyl ester, 2-(ethoxycarbonyl)-3,4-dimethoxybenzoic acid, 3,4-dimethoxy-phthalic acid-2-ethyl ester, 3,4-dimethoxy-2-carbethoxybenzoic acid, 3,4-Dimethoxy-phthalsaeure-2-aethylester, Hemipinsaeure-aethylester-(2). |