3-((Ethyl(phenyl)amino)methyl)benzenesulfonic acid structure
|
Common Name | 3-((Ethyl(phenyl)amino)methyl)benzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 101-11-1 | Molecular Weight | 291.365 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H17NO3S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | 3-((Ethyl(phenyl)amino)methyl)benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.365 |
| Exact Mass | 291.092926 |
| PSA | 65.99000 |
| LogP | 3.00 |
| Index of Refraction | 1.617 |
| InChIKey | BQGRVFPPZJPWPB-UHFFFAOYSA-N |
| SMILES | CCN(Cc1cccc(S(=O)(=O)O)c1)c1ccccc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2921499090 |
|
~%
3-((Ethyl(pheny... CAS#:101-11-1 |
| Literature: Helvetica Chimica Acta, , vol. 25, p. 1162 |
|
~%
Detail
|
| Literature: Helvetica Chimica Acta, , vol. 25, p. 1162 |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 202-916-8 |
| 3-{[Ethyl(phenyl)amino]methyl}benzenesulfonic acid |
| MFCD00035761 |
| Benzenesulfonic acid, 3-[(ethylphenylamino)methyl]- |
| 3-[(N-ethylanilino)methyl]benzenesulfonic acid |