Benzenesulfonic acid,4-(phenylamino)- structure
|
Common Name | Benzenesulfonic acid,4-(phenylamino)- | ||
|---|---|---|---|---|
| CAS Number | 101-57-5 | Molecular Weight | 249.28600 | |
| Density | 1.398 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H11NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-anilinobenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.398 g/cm3 |
|---|---|
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.28600 |
| Exact Mass | 249.04600 |
| PSA | 74.78000 |
| LogP | 3.83070 |
| Index of Refraction | 1.655 |
| InChIKey | HYKDWGUFDOYDGV-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc(Nc2ccccc2)cc1 |
| HS Code | 2921499090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-(phenylamino)benzenesulphonic acid |
| diphenylamine sulfonic acid |
| Diphenylaminosulfonic acid |
| EINECS 202-955-0 |
| Benzenesulfonic acid,4-(phenylamino) |
| N-phenyl-sulfanilic acid |
| Benzenesulfonic acid,p-anilino |
| Diphenylamine-4-sulfonic acid |
| N-Phenyl-sulfanilsaeure |
| p-Anilinobenzenesulfonic acid |
| 4-Sulfodiphenylamine |
| N-Phenyl-p-aminobenzenesulfonic acid |
| diphenylamine-4-sulphonic acid |
| 4-Anilino-benzol-sulfonsaeure-(1) |