Acetamide,N,N-diphenyl structure
|
Common Name | Acetamide,N,N-diphenyl | ||
|---|---|---|---|---|
| CAS Number | 519-87-9 | Molecular Weight | 211.26 | |
| Density | 1.125g/cm3 | Boiling Point | 130 °C0.02 mm Hg(lit.) | |
| Molecular Formula | C14H13NO | Melting Point | 100-103 °C(lit.) | |
| MSDS | N/A | Flash Point | 199.7ºC | |
Use of Acetamide,N,N-diphenylN,N-Diphenylacetamide (N-Acetyldiphenylamine) has N,N-disubstituted amide group and can be used as a mono- as well as a bidentate ligand generating four-membered chelate rings[1]. |
| Name | n,n-diphenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Description | N,N-Diphenylacetamide (N-Acetyldiphenylamine) has N,N-disubstituted amide group and can be used as a mono- as well as a bidentate ligand generating four-membered chelate rings[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.125g/cm3 |
|---|---|
| Boiling Point | 130 °C0.02 mm Hg(lit.) |
| Melting Point | 100-103 °C(lit.) |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 |
| Flash Point | 199.7ºC |
| Exact Mass | 211.10000 |
| PSA | 20.31000 |
| LogP | 3.37120 |
| Index of Refraction | 1.609 |
| InChIKey | DKLYDESVXZKCFI-UHFFFAOYSA-N |
| SMILES | CC(=O)N(c1ccccc1)c1ccccc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| RTECS | AB8133000 |
| HS Code | 2924299090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| N,N-diphenyl-acetamide |
| N-Phenylacetanilide |
| N,N-Diphenyl-acetamid |
| Essigsaeure-diphenylamid |
| MFCD00008685 |
| N-Acetyldiphenylamine |
| Diphenylacetamide |
| EINECS 208-277-1 |
| ACETAMIDE,N,N-DIPHENYL |