N,N,N-Triethylanilinium iodide structure
|
Common Name | N,N,N-Triethylanilinium iodide | ||
|---|---|---|---|---|
| CAS Number | 1010-19-1 | Molecular Weight | 305.198 | |
| Density | 1.3379 (estimate) | Boiling Point | N/A | |
| Molecular Formula | C12H20IN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N,N,N-Triethylanilinium iodideTriethylphenylammonium Iodide is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | triethyl(phenyl)azanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Description | Triethylphenylammonium Iodide is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.3379 (estimate) |
|---|---|
| Molecular Formula | C12H20IN |
| Molecular Weight | 305.198 |
| Exact Mass | 305.064026 |
| LogP | 0.05760 |
| InChIKey | WMSWXWGJYOIACA-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)c1ccccc1.[I-] |
| Water Solubility | almost transparency |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 37/39-26 |
| RIDADR | UN 2811 |
| Packaging Group | III |
| Hazard Class | 6.1 |
|
~%
N,N,N-Triethyla... CAS#:1010-19-1 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 79, p. 18 Justus Liebigs Annalen der Chemie, , vol. 78, p. 263,266 |
| Phenyltriethylammonium iodide |
| Benzenaminium, N,N,N-triethyl-, iodide (1:1) |
| N,N,N-Triethylbenzenaminium iodide |
| MFCD00050224 |
| Benzenaminium, N,N,N-triethyl-, iodide |
| Phenyl-triaethyl-ammoniumjodid |
| tri-N-ethyl-anilinium,iodide |
| benzyltriethylammonium iodide |
| N,N,N-Triethylanilinium iodide |
| Triethyl-Phenylazanium Iodide |
| EINECS 213-774-1 |
| TriethylphenylaMMoniuM Iodide |
| Tri-N-aethyl-anilinium,Jodid |
| Triaethyl-phenyl-ammonium |