3-Carboxy-5-nitrobenzeneboronic acid structure
|
Common Name | 3-Carboxy-5-nitrobenzeneboronic acid | ||
|---|---|---|---|---|
| CAS Number | 101084-81-5 | Molecular Weight | 210.937 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 502.6±60.0 °C at 760 mmHg | |
| Molecular Formula | C7H6BNO6 | Melting Point | 229 °C | |
| MSDS | Chinese | Flash Point | 257.8±32.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-Carboxy-5-nitrophenylboronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 502.6±60.0 °C at 760 mmHg |
| Melting Point | 229 °C |
| Molecular Formula | C7H6BNO6 |
| Molecular Weight | 210.937 |
| Flash Point | 257.8±32.9 °C |
| Exact Mass | 211.028824 |
| PSA | 123.58000 |
| LogP | 1.19 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.620 |
| InChIKey | WNIFCLWDGNHGMX-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(B(O)O)cc([N+](=O)[O-])c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R20/21/22 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2931900090 |
|
~51%
3-Carboxy-5-nit... CAS#:101084-81-5 |
| Literature: Ramalingam, Kondareddiar; Nowotnik, David P. Organic Preparations and Procedures International, 1991 , vol. 23, # 6 p. 729 - 734 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| WNR CVQ EBQQ |
| 3-borono-5-nitrobenzoic acid |
| 5-Nitro-3-carboxyphenylboronic acid |
| MFCD00757433 |
| 3-Carboxy-5-nitrobenzeneboronic acid |
| Benzoic acid, 3-borono-5-nitro- |
| 3-Carboxy-5-Nitrophenylboronic Acid |
| 3-(dihydroxyboranyl)-5-nitrobenzoic acid |
| 3-(Dihydroxyboryl)-5-nitrobenzoic acid |