2-Methoxy-4-nitrobenzonitrile structure
|
Common Name | 2-Methoxy-4-nitrobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 101084-96-2 | Molecular Weight | 178.14500 | |
| Density | 1.324g/cm3 | Boiling Point | 364.545ºC at 760 mmHg | |
| Molecular Formula | C8H6N2O3 | Melting Point | 177-180ºC(lit.) | |
| MSDS | USA | Flash Point | 174.271ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Methoxy-4-nitrobenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.324g/cm3 |
|---|---|
| Boiling Point | 364.545ºC at 760 mmHg |
| Melting Point | 177-180ºC(lit.) |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.14500 |
| Flash Point | 174.271ºC |
| Exact Mass | 178.03800 |
| PSA | 78.84000 |
| LogP | 1.99828 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | MLIKCKXLGYEGAO-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])ccc1C#N |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S26 |
| RIDADR | UN3439 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2926909090 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Development of 2-thioxoquinazoline-4-one derivatives as dual and selective inhibitors of dynamin-related protein 1 (Drp1) and puromycin-sensitive aminopeptidase (PSA).
Chem. Pharm. Bull. 62(10) , 979-88, (2014) An established inhibitor of dynamin-related protein 1 (Drp1), 3-(2,4-dichloro-5-methoxyphenyl)-2-thioxoquinazoline-4-one (mdivi-1), was recently reported also to show potent puromycin-sensitive aminop... |
| MFCD02093781 |
| 2-methoxy-4-nitrobenzonitrile |
| 2-CYANO-5-NITROANISOLE |