4-(Trimethylsilyloxy)benzaldehyde structure
|
Common Name | 4-(Trimethylsilyloxy)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 1012-12-0 | Molecular Weight | 194.303 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 230.6±23.0 °C at 760 mmHg | |
| Molecular Formula | C10H14O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 77.6±18.2 °C | |
| Name | 4-trimethylsilyloxybenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 230.6±23.0 °C at 760 mmHg |
| Molecular Formula | C10H14O2Si |
| Molecular Weight | 194.303 |
| Flash Point | 77.6±18.2 °C |
| Exact Mass | 194.076309 |
| PSA | 26.30000 |
| LogP | -0.99 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.507 |
| InChIKey | FLVQNLXVIRUAPB-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)Oc1ccc(C=O)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2931900090 |
|
~95%
4-(Trimethylsil... CAS#:1012-12-0 |
| Literature: Plieninger; Schwarz; Jaggy; et al. 1986 , vol. 1986, # 10 p. 1772 - 1778 |
|
~75%
4-(Trimethylsil... CAS#:1012-12-0 |
| Literature: Farhadi, Saeid; Zaringhadam, Parisa; Sahamieh, Reza Zarei Tetrahedron Letters, 2006 , vol. 47, # 12 p. 1965 - 1968 |
|
~%
4-(Trimethylsil... CAS#:1012-12-0 |
| Literature: US5464865 A1, ; US 5464865 A |
|
~%
4-(Trimethylsil... CAS#:1012-12-0 |
| Literature: Phytochemistry (Elsevier), , vol. 29, # 5 p. 1653 - 1659 |
|
~%
4-(Trimethylsil... CAS#:1012-12-0 |
| Literature: Organic Mass Spectrometry, , vol. 20, # 10 p. 614 - 618 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 4-(Trimethylsilyloxy)benzaldehyde |
| Benzaldehyde, p-(trimethylsiloxy)- |
| VHR DO-SI-1&1&1 |
| EINECS 213-789-3 |
| p-((Trimethylsilyl)oxy)benzaldehyde |
| MFCD00040723 |
| 4-((Trimethylsilyl)oxy)benzaldehyde |
| 4-[(Trimethylsilyl)oxy]benzaldehyde |
| Benzaldehyde, 4-[(trimethylsilyl)oxy]- |