Noreugenin structure
|
Common Name | Noreugenin | ||
|---|---|---|---|---|
| CAS Number | 1013-69-0 | Molecular Weight | 192.168 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 394.6±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H8O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.0±21.4 °C | |
Use of NoreugeninNoreugenin, 5,7-dihydroxy-2-methyl-4H-chromen-4-one, is a new chromone from Hymenocallis littoralis Salisb. (Amaryllidaceae)[1]. |
| Name | 5,7-dihydroxy-2-methylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Noreugenin, 5,7-dihydroxy-2-methyl-4H-chromen-4-one, is a new chromone from Hymenocallis littoralis Salisb. (Amaryllidaceae)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 394.6±42.0 °C at 760 mmHg |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.168 |
| Flash Point | 164.0±21.4 °C |
| Exact Mass | 192.042252 |
| PSA | 70.67000 |
| LogP | 1.58 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | NCUJRUDLFCGVOE-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)c2c(O)cc(O)cc2o1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914400090 |
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 5,7-Dihydroxy-2-methyl-4H-1-benzopyran-4-one |
| 2-Methyl-5,7-dihydroxychromone |
| 5,7-Dihydroxy-2-methyl-4H-chromen-4-one |
| 5,7-Dihydroxy-2-methylchromone |
| 4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-methyl- |
| 4H-1-Benzopyran-4-one,5,7-dihydroxy-2-methyl |
| 5,7-dihydroxy-2-methylbenzopyran-4-one |
| Noreugenin |
| CPD-0 |