3'-O-Methylbatatasin III structure
|
Common Name | 3'-O-Methylbatatasin III | ||
|---|---|---|---|---|
| CAS Number | 101330-69-2 | Molecular Weight | 258.31200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3'-O-Methylbatatasin III3'-O-Methylbatatasin III shows spasmolytic activity[1]. |
| Name | 3-methoxy-5-[2-(3-methoxyphenyl)ethyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Description | 3'-O-Methylbatatasin III shows spasmolytic activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H18O3 |
|---|---|
| Molecular Weight | 258.31200 |
| Exact Mass | 258.12600 |
| PSA | 38.69000 |
| LogP | 3.19460 |
| InChIKey | FDJURJXPMJANDW-UHFFFAOYSA-N |
| SMILES | COc1cccc(CCc2cc(O)cc(OC)c2)c1 |
| Hazard Codes | Xi |
|---|
|
~%
3'-O-Methylbata... CAS#:101330-69-2 |
| Literature: Hernandez-Romero, Yanet; Rojas, Juana-Isela; Castillo, Rafael; Rojas, Alejandra; Mata, Rachel Journal of Natural Products, 2004 , vol. 67, # 2 p. 160 - 167 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Phenol,3-methoxy-5-[2-(3-methoxyphenyl)ethyl] |
| 3'-O-Methylbatatasin III |
| 5-O-methylbatatasin III |
| 3'-O-methylbatatacin III |
| 3',5-dimethoxy-3-hydroxybibenzyl |