propan-2-yl 2-(1,3-dioxoisoindol-2-yl)acetate structure
|
Common Name | propan-2-yl 2-(1,3-dioxoisoindol-2-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 101855-37-2 | Molecular Weight | 247.24700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | propan-2-yl 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H13NO4 |
|---|---|
| Molecular Weight | 247.24700 |
| Exact Mass | 247.08400 |
| PSA | 63.68000 |
| LogP | 1.17210 |
| InChIKey | URWXPEIUWRCVQL-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)CN1C(=O)c2ccccc2C1=O |
|
~60%
propan-2-yl 2-(... CAS#:101855-37-2 |
| Literature: Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, , vol. 24, p. 685 - 686 |
|
~%
propan-2-yl 2-(... CAS#:101855-37-2 |
| Literature: Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, , vol. 24, p. 685 - 686 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| N-Phthalylglycin-isopropylester |
| 2H-Isoindole-2-acetic acid,1,3-dihydro-1,3-dioxo-,1-methylethyl ester |