Bis(4-methylphenyl)phosphinous chloride structure
|
Common Name | Bis(4-methylphenyl)phosphinous chloride | ||
|---|---|---|---|---|
| CAS Number | 1019-71-2 | Molecular Weight | 248.68800 | |
| Density | 1.159 | Boiling Point | 346.9±31.0 °C at 760 mmHg | |
| Molecular Formula | C14H14ClP | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 163.6±24.8 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | Bis(4-methylphenyl)chlorophosphine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.159 |
|---|---|
| Boiling Point | 346.9±31.0 °C at 760 mmHg |
| Molecular Formula | C14H14ClP |
| Molecular Weight | 248.68800 |
| Flash Point | 163.6±24.8 °C |
| Exact Mass | 248.05200 |
| PSA | 13.59000 |
| LogP | 6.25 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | n20/D1.501 |
| InChIKey | BJBXRRHIBSXGLF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(P(Cl)c2ccc(C)cc2)cc1 |
| Water Solubility | Reacts with water. |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Supplemental HS | Reacts violently with water. |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Phrases | R14;R34 |
| Safety Phrases | S26;S45;S36/S37/S39 |
| RIDADR | UN 1760 8/PG 2 |
| WGK Germany | 3.0 |
| Packaging Group | II |
| HS Code | 2903999090 |
|
~66%
Bis(4-methylphe... CAS#:1019-71-2 |
| Literature: Narsireddy, Meda; Yamamoto, Yoshinori Journal of Organic Chemistry, 2008 , vol. 73, # 24 p. 9698 - 9709 |
|
~%
Bis(4-methylphe... CAS#:1019-71-2 |
| Literature: Journal of the American Chemical Society, , vol. 129, # 25 p. 7734 - 7735 |
|
~%
Bis(4-methylphe... CAS#:1019-71-2 |
| Literature: Journal of the American Chemical Society, , vol. 100, p. 7304 - 7311 |
|
~61%
Bis(4-methylphe... CAS#:1019-71-2 |
| Literature: Kormachev, V. V.; Vasil'eva, T. V. J. Gen. Chem. USSR (Engl. Transl.), 1988 , vol. 58, # 1 p. 224 - 225,199 - 200 |
| Precursor 5 | |
|---|---|
| DownStream 4 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Chlorodi(p-tolyl)phosphine |
| Bis(4-methylphenyl)phosphinous chloride |
| MFCD01630844 |
| chlorodip-tolylphosphine |
| Phosphinous chloride, P,P-bis(4-methylphenyl)- |
| chloro-bis(4-methylphenyl)phosphane |